C17H29F3IN5O2S — CID 111617262
ethyl N-[1-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide (PubChem CID 111617262) has the molecular formula C17H29F3IN5O2S and a molecular weight of 551.42 g/mol. Its IUPAC name is ethyl N-[1-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide.
| Compound Name | ethyl N-[1-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111617262 |
| Molecular Formula | C17H29F3IN5O2S |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | ethyl N-[1-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]-4-methylpentan-2-yl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCC(CC(C)C)NC(=O)OCC.I |
| InChI | InChI=1S/C17H28F3N5O2S.HI/c1-5-21-15(23-9-14-25-13(10-28-14)17(18,19)20)22-8-12(7-11(3)4)24-16(26)27-6-2;/h10-12H,5-9H2,1-4H3,(H,24,26)(H2,21,22,23);1H |
| InChIKey | SVDXDIYRXVHDTM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|