C16H23F3IN5S2 — CID 111616191
1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616191) has the molecular formula C16H23F3IN5S2 and a molecular weight of 533.43 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616191 |
| Molecular Formula | C16H23F3IN5S2 |
| Molecular Weight | 533.43 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | 1-ethyl-3-[4-(4-methyl-1,3-thiazol-2-yl)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCCCc1nc(C)cs1.I |
| InChI | InChI=1S/C16H22F3N5S2.HI/c1-3-20-15(21-7-5-4-6-13-23-11(2)9-25-13)22-8-14-24-12(10-26-14)16(17,18)19;/h9-10H,3-8H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | GEUBYAFBUSFZAP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|