C17H24F3IN6S — CID 111616199
1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111616199) has the molecular formula C17H24F3IN6S and a molecular weight of 528.39 g/mol. Its IUPAC name is 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111616199 |
| Molecular Formula | C17H24F3IN6S |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 1-ethyl-3-[4-(pyridin-2-ylamino)butyl]-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCCCNc1ccccn1.I |
| InChI | InChI=1S/C17H23F3N6S.HI/c1-2-21-16(25-11-15-26-13(12-27-15)17(18,19)20)24-10-6-5-9-23-14-7-3-4-8-22-14;/h3-4,7-8,12H,2,5-6,9-11H2,1H3,(H,22,23)(H2,21,24,25);1H |
| InChIKey | MORMZUQTVGDXCK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|