C12H20F3IN4OS — CID 111615404
1-ethyl-3-(3-methoxypropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111615404) has the molecular formula C12H20F3IN4OS and a molecular weight of 452.28 g/mol. Its IUPAC name is 1-ethyl-3-(3-methoxypropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(3-methoxypropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111615404 |
| Molecular Formula | C12H20F3IN4OS |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 1-ethyl-3-(3-methoxypropyl)-2-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCCOC.I |
| InChI | InChI=1S/C12H19F3N4OS.HI/c1-3-16-11(17-5-4-6-20-2)18-7-10-19-9(8-21-10)12(13,14)15;/h8H,3-7H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | SOFTXJBAHRBWGQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|