C17H32N4O2S — CID 111840199
2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine (PubChem CID 111840199) has the molecular formula C17H32N4O2S and a molecular weight of 356.54 g/mol. Its IUPAC name is 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine.
| Compound Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111840199 |
| Molecular Formula | C17H32N4O2S |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-[(4-tert-butyl-1,3-thiazol-2-yl)methyl]-1-ethyl-3-[3-(2-methoxyethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C(C)(C)C)cs1)NCCCOCCOC |
| InChI | InChI=1S/C17H32N4O2S/c1-6-18-16(19-8-7-9-23-11-10-22-5)20-12-15-21-14(13-24-15)17(2,3)4/h13H,6-12H2,1-5H3,(H2,18,19,20) |
| InChIKey | JCCOJCLJDUHTIO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|