C16H30N4OS — CID 111548101
1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine (PubChem CID 111548101) has the molecular formula C16H30N4OS and a molecular weight of 326.51 g/mol. Its IUPAC name is 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 111548101 |
| Molecular Formula | C16H30N4OS |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | 1-[2-(4-tert-butyl-1,3-thiazol-2-yl)ethyl]-3-ethyl-2-(3-methoxypropyl)guanidine |
| SMILES | CCN/C(=N\CCCOC)NCCc1nc(C(C)(C)C)cs1 |
| InChI | InChI=1S/C16H30N4OS/c1-6-17-15(18-9-7-11-21-5)19-10-8-14-20-13(12-22-14)16(2,3)4/h12H,6-11H2,1-5H3,(H2,17,18,19) |
| InChIKey | MODLLLICFQHDIV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|