C13H22F3IN4OS — CID 111688467
1-ethyl-2-(3-methoxypropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide (PubChem CID 111688467) has the molecular formula C13H22F3IN4OS and a molecular weight of 466.31 g/mol. Its IUPAC name is 1-ethyl-2-(3-methoxypropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-methoxypropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111688467 |
| Molecular Formula | C13H22F3IN4OS |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 1-ethyl-2-(3-methoxypropyl)-3-[2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC)NCCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C13H21F3N4OS.HI/c1-3-17-12(18-6-4-8-21-2)19-7-5-11-20-10(9-22-11)13(14,15)16;/h9H,3-8H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | JNHDEPPDMFXYHW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|