C16H26F3N5O2S — CID 111617803
tert-butyl N-[3-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111617803) has the molecular formula C16H26F3N5O2S and a molecular weight of 409.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111617803 |
| Molecular Formula | C16H26F3N5O2S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26F3N5O2S/c1-5-20-13(21-7-6-8-22-14(25)26-15(2,3)4)23-9-12-24-11(10-27-12)16(17,18)19/h10H,5-9H2,1-4H3,(H,22,25)(H2,20,21,23) |
| InChIKey | RHUCRZDPJMBWJM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|