C19H31F3IN5O2S — CID 111616786
tert-butyl 4-[[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111616786) has the molecular formula C19H31F3IN5O2S and a molecular weight of 577.46 g/mol. Its IUPAC name is tert-butyl 4-[[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111616786 |
| Molecular Formula | C19H31F3IN5O2S |
| Molecular Weight | 577.46 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | tert-butyl 4-[[[N-ethyl-N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(C(F)(F)F)cs1)NCC1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C19H30F3N5O2S.HI/c1-5-23-16(25-11-15-26-14(12-30-15)19(20,21)22)24-10-13-6-8-27(9-7-13)17(28)29-18(2,3)4;/h12-13H,5-11H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | LKAJNKXNPODALR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|