C15H23F3IN5O2S — CID 111815243
tert-butyl 4-[N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111815243) has the molecular formula C15H23F3IN5O2S and a molecular weight of 521.35 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111815243 |
| Molecular Formula | C15H23F3IN5O2S |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | tert-butyl 4-[N'-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/Cc2nc(C(F)(F)F)cs2)CC1.I |
| InChI | InChI=1S/C15H22F3N5O2S.HI/c1-14(2,3)25-13(24)23-6-4-22(5-7-23)12(19)20-8-11-21-10(9-26-11)15(16,17)18;/h9H,4-8H2,1-3H3,(H2,19,20);1H |
| InChIKey | FHJFEGSNVLQWBM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|