C16H28IN5O3 — CID 111078932
tert-butyl 4-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111078932) has the molecular formula C16H28IN5O3 and a molecular weight of 465.34 g/mol. Its IUPAC name is tert-butyl 4-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111078932 |
| Molecular Formula | C16H28IN5O3 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | tert-butyl 4-[N'-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | Cc1nc(C/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)oc1C.I |
| InChI | InChI=1S/C16H27N5O3.HI/c1-11-12(2)23-13(19-11)10-18-14(17)20-6-8-21(9-7-20)15(22)24-16(3,4)5;/h6-10H2,1-5H3,(H2,17,18);1H |
| InChIKey | PUXKUPDKEZBHOS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|