C18H30N6O2 — CID 109394785
tert-butyl 4-[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 109394785) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109394785 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | tert-butyl 4-[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CN(C)c1cccc(C/N=C(\N)N2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C18H30N6O2/c1-18(2,3)26-17(25)24-11-9-23(10-12-24)16(19)20-13-14-7-6-8-15(21-14)22(4)5/h6-8H,9-13H2,1-5H3,(H2,19,20) |
| InChIKey | YQSQPYNENJRJAD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|