C20H32N6O3 — CID 111095984
tert-butyl 4-[N'-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111095984) has the molecular formula C20H32N6O3 and a molecular weight of 404.52 g/mol. Its IUPAC name is tert-butyl 4-[N'-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111095984 |
| Molecular Formula | C20H32N6O3 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | tert-butyl 4-[N'-[2-[methyl(2-pyridin-2-ylethyl)amino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CN(CCc1ccccn1)C(=O)C/N=C(\N)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H32N6O3/c1-20(2,3)29-19(28)26-13-11-25(12-14-26)18(21)23-15-17(27)24(4)10-8-16-7-5-6-9-22-16/h5-7,9H,8,10-15H2,1-4H3,(H2,21,23) |
| InChIKey | UVYALMLZVPKCNL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|