C16H25N5O2 — CID 111023278
tert-butyl 4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111023278) has the molecular formula C16H25N5O2 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl 4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111023278 |
| Molecular Formula | C16H25N5O2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl 4-[N'-(pyridin-2-ylmethyl)carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/Cc2ccccn2)CC1 |
| InChI | InChI=1S/C16H25N5O2/c1-16(2,3)23-15(22)21-10-8-20(9-11-21)14(17)19-12-13-6-4-5-7-18-13/h4-7H,8-12H2,1-3H3,(H2,17,19) |
| InChIKey | SVURLFFVPZCUTJ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|