C19H33IN6O2 — CID 109466693
tert-butyl 3-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466693) has the molecular formula C19H33IN6O2 and a molecular weight of 504.42 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466693 |
| Molecular Formula | C19H33IN6O2 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | tert-butyl 3-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)n1)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C19H32N6O2.HI/c1-7-20-17(21-11-14-9-8-10-16(22-14)24(5)6)23-15-12-25(13-15)18(26)27-19(2,3)4;/h8-10,15H,7,11-13H2,1-6H3,(H2,20,21,23);1H |
| InChIKey | WHYROIMBXYUYES-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|