C22H39IN6O2 — CID 109405486
tert-butyl N-[4-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide (PubChem CID 109405486) has the molecular formula C22H39IN6O2 and a molecular weight of 546.50 g/mol. Its IUPAC name is tert-butyl N-[4-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[4-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109405486 |
| Molecular Formula | C22H39IN6O2 |
| Molecular Weight | 546.50 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | tert-butyl N-[4-[[N'-[[6-(dimethylamino)-2-pyridinyl]methyl]-N-ethylcarbamimidoyl]amino]cyclohexyl]carbamate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)n1)NC1CCC(NC(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C22H38N6O2.HI/c1-7-23-20(24-15-18-9-8-10-19(25-18)28(5)6)26-16-11-13-17(14-12-16)27-21(29)30-22(2,3)4;/h8-10,16-17H,7,11-15H2,1-6H3,(H,27,29)(H2,23,24,26);1H |
| InChIKey | WJTPJFXQFSYWJJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|