C19H34IN5OS — CID 109438472
2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide (PubChem CID 109438472) has the molecular formula C19H34IN5OS and a molecular weight of 507.49 g/mol. Its IUPAC name is 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide.
| Compound Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109438472 |
| Molecular Formula | C19H34IN5OS |
| Molecular Weight | 507.49 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-(3-ethylsulfinylcyclohexyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)n1)NC1CCCC(S(=O)CC)C1.I |
| InChI | InChI=1S/C19H33N5OS.HI/c1-5-20-19(21-14-16-10-8-12-18(22-16)24(3)4)23-15-9-7-11-17(13-15)26(25)6-2;/h8,10,12,15,17H,5-7,9,11,13-14H2,1-4H3,(H2,20,21,23);1H |
| InChIKey | SSYOBBIHHXUYQN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|