C23H34N6O — CID 109405835
2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[1-(3-methoxyphenyl)piperidin-3-yl]guanidine (PubChem CID 109405835) has the molecular formula C23H34N6O and a molecular weight of 410.57 g/mol. Its IUPAC name is 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[1-(3-methoxyphenyl)piperidin-3-yl]guanidine.
| Compound Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[1-(3-methoxyphenyl)piperidin-3-yl]guanidine |
|---|---|
| PubChem CID | 109405835 |
| Molecular Formula | C23H34N6O |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 2-[[6-(dimethylamino)-2-pyridinyl]methyl]-1-ethyl-3-[1-(3-methoxyphenyl)piperidin-3-yl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(N(C)C)n1)NC1CCCN(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C23H34N6O/c1-5-24-23(25-16-18-9-6-13-22(26-18)28(2)3)27-19-10-8-14-29(17-19)20-11-7-12-21(15-20)30-4/h6-7,9,11-13,15,19H,5,8,10,14,16-17H2,1-4H3,(H2,24,25,27) |
| InChIKey | QPLLDVKIVLCVIB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|