C22H37N5O2 — CID 111996415
N-[2-[[ethylamino-[[1-(3-methoxyphenyl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111996415) has the molecular formula C22H37N5O2 and a molecular weight of 403.57 g/mol. Its IUPAC name is N-[2-[[ethylamino-[[1-(3-methoxyphenyl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[ethylamino-[[1-(3-methoxyphenyl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111996415 |
| Molecular Formula | C22H37N5O2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | N-[2-[[ethylamino-[[1-(3-methoxyphenyl)piperidin-3-yl]amino]methylidene]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCN/C(=N\CCNC(=O)C(C)(C)C)NC1CCCN(c2cccc(OC)c2)C1 |
| InChI | InChI=1S/C22H37N5O2/c1-6-23-21(25-13-12-24-20(28)22(2,3)4)26-17-9-8-14-27(16-17)18-10-7-11-19(15-18)29-5/h7,10-11,15,17H,6,8-9,12-14,16H2,1-5H3,(H,24,28)(H2,23,25,26) |
| InChIKey | IEXPCLRVJKTOCK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|