C21H30IN5O2 — CID 109466351
tert-butyl 3-[[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109466351) has the molecular formula C21H30IN5O2 and a molecular weight of 511.41 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109466351 |
| Molecular Formula | C21H30IN5O2 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-(quinolin-8-ylmethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc2cccnc12)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C21H29N5O2.HI/c1-5-22-19(25-17-13-26(14-17)20(27)28-21(2,3)4)24-12-16-9-6-8-15-10-7-11-23-18(15)16;/h6-11,17H,5,12-14H2,1-4H3,(H2,22,24,25);1H |
| InChIKey | YSDVIIQNBSSANI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|