C18H30IN5O3 — CID 109467467
tert-butyl 3-[[N-ethyl-N'-(2-pyridin-3-yloxyethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109467467) has the molecular formula C18H30IN5O3 and a molecular weight of 491.37 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-(2-pyridin-3-yloxyethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-(2-pyridin-3-yloxyethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109467467 |
| Molecular Formula | C18H30IN5O3 |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-(2-pyridin-3-yloxyethyl)carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCOc1cccnc1)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C18H29N5O3.HI/c1-5-20-16(21-9-10-25-15-7-6-8-19-11-15)22-14-12-23(13-14)17(24)26-18(2,3)4;/h6-8,11,14H,5,9-10,12-13H2,1-4H3,(H2,20,21,22);1H |
| InChIKey | YAWWQZHRYPAXRD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|