C20H32IN7O2 — CID 109465929
tert-butyl 3-[[N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109465929) has the molecular formula C20H32IN7O2 and a molecular weight of 529.43 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109465929 |
| Molecular Formula | C20H32IN7O2 |
| Molecular Weight | 529.43 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nnc2ccccn12)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C20H31N7O2.HI/c1-5-21-18(23-15-13-26(14-15)19(28)29-20(2,3)4)22-11-8-10-17-25-24-16-9-6-7-12-27(16)17;/h6-7,9,12,15H,5,8,10-11,13-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | UQBFARIOSJXELN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|