C19H31N7O2 — CID 111886225
tert-butyl N-[3-[[ethylamino-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methylidene]amino]propyl]carbamate (PubChem CID 111886225) has the molecular formula C19H31N7O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[ethylamino-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[ethylamino-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886225 |
| Molecular Formula | C19H31N7O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | tert-butyl N-[3-[[ethylamino-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methylidene]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CCCNC(=O)OC(C)(C)C)NCCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H31N7O2/c1-5-20-17(21-11-8-12-23-18(27)28-19(2,3)4)22-13-10-16-25-24-15-9-6-7-14-26(15)16/h6-7,9,14H,5,8,10-13H2,1-4H3,(H,23,27)(H2,20,21,22) |
| InChIKey | FHDGVYJCHKKKDO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|