C21H36N8O2 — CID 109465438
tert-butyl 3-[[N-ethyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109465438) has the molecular formula C21H36N8O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109465438 |
| Molecular Formula | C21H36N8O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\CCN1CCN(c2ncccn2)CC1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C21H36N8O2/c1-5-22-18(26-17-15-29(16-17)20(30)31-21(2,3)4)23-9-10-27-11-13-28(14-12-27)19-24-7-6-8-25-19/h6-8,17H,5,9-16H2,1-4H3,(H2,22,23,26) |
| InChIKey | LWXSZLAIBWPWNF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|