C16H26IN7 — CID 136921962
1-ethyl-3-prop-2-ynyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 136921962) has the molecular formula C16H26IN7 and a molecular weight of 443.34 g/mol. Its IUPAC name is 1-ethyl-3-prop-2-ynyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-prop-2-ynyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 136921962 |
| Molecular Formula | C16H26IN7 |
| Molecular Weight | 443.34 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-ethyl-3-prop-2-ynyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C#CCN/C(=N/CCN1CCN(c2ncccn2)CC1)NCC.I |
| InChI | InChI=1S/C16H25N7.HI/c1-3-6-18-15(17-4-2)19-9-10-22-11-13-23(14-12-22)16-20-7-5-8-21-16;/h1,5,7-8H,4,6,9-14H2,2H3,(H2,17,18,19);1H |
| InChIKey | WZOUHJPBZBUCNU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|