C16H29N7 — CID 111124903
1-ethyl-3-propan-2-yl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111124903) has the molecular formula C16H29N7 and a molecular weight of 319.46 g/mol. Its IUPAC name is 1-ethyl-3-propan-2-yl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-ethyl-3-propan-2-yl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111124903 |
| Molecular Formula | C16H29N7 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-ethyl-3-propan-2-yl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCN1CCN(c2ncccn2)CC1)NC(C)C |
| InChI | InChI=1S/C16H29N7/c1-4-17-15(21-14(2)3)18-8-9-22-10-12-23(13-11-22)16-19-6-5-7-20-16/h5-7,14H,4,8-13H2,1-3H3,(H2,17,18,21) |
| InChIKey | UNGMKSODEIKMDR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|