C18H37IN4O4 — CID 109465431
tert-butyl 3-[[N-ethyl-N'-[4-(2-methoxyethoxy)butyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide (PubChem CID 109465431) has the molecular formula C18H37IN4O4 and a molecular weight of 500.42 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[4-(2-methoxyethoxy)butyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[4-(2-methoxyethoxy)butyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 109465431 |
| Molecular Formula | C18H37IN4O4 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[4-(2-methoxyethoxy)butyl]carbamimidoyl]amino]azetidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCCOC)NC1CN(C(=O)OC(C)(C)C)C1.I |
| InChI | InChI=1S/C18H36N4O4.HI/c1-6-19-16(20-9-7-8-10-25-12-11-24-5)21-15-13-22(14-15)17(23)26-18(2,3)4;/h15H,6-14H2,1-5H3,(H2,19,20,21);1H |
| InChIKey | VRALJIMJDUKIPT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|