C15H30N4O4S — CID 109466026
tert-butyl 3-[[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466026) has the molecular formula C15H30N4O4S and a molecular weight of 362.50 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466026 |
| Molecular Formula | C15H30N4O4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-(3-methylsulfonylpropyl)carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\CCCS(C)(=O)=O)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C15H30N4O4S/c1-6-16-13(17-8-7-9-24(5,21)22)18-12-10-19(11-12)14(20)23-15(2,3)4/h12H,6-11H2,1-5H3,(H2,16,17,18) |
| InChIKey | QQPCSFWQHPILFG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|