C17H33N5O3 — CID 109466338
tert-butyl 3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466338) has the molecular formula C17H33N5O3 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl 3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466338 |
| Molecular Formula | C17H33N5O3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | tert-butyl 3-[[N'-[2-(tert-butylamino)-2-oxoethyl]-N-ethylcarbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H33N5O3/c1-8-18-14(19-9-13(23)21-16(2,3)4)20-12-10-22(11-12)15(24)25-17(5,6)7/h12H,8-11H2,1-7H3,(H,21,23)(H2,18,19,20) |
| InChIKey | DYXQBPOBCCURDI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|