C18H29IN4O4S — CID 111045093
tert-butyl 4-[N'-[(4-methylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111045093) has the molecular formula C18H29IN4O4S and a molecular weight of 524.43 g/mol. Its IUPAC name is tert-butyl 4-[N'-[(4-methylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[(4-methylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111045093 |
| Molecular Formula | C18H29IN4O4S |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | tert-butyl 4-[N'-[(4-methylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/Cc2ccc(S(C)(=O)=O)cc2)CC1.I |
| InChI | InChI=1S/C18H28N4O4S.HI/c1-18(2,3)26-17(23)22-11-9-21(10-12-22)16(19)20-13-14-5-7-15(8-6-14)27(4,24)25;/h5-8H,9-13H2,1-4H3,(H2,19,20);1H |
| InChIKey | YTWGLULIFKDREO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 105.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|