C21H33FIN5O2S — CID 111088428
tert-butyl 4-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111088428) has the molecular formula C21H33FIN5O2S and a molecular weight of 565.50 g/mol. Its IUPAC name is tert-butyl 4-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111088428 |
| Molecular Formula | C21H33FIN5O2S |
| Molecular Weight | 565.50 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | tert-butyl 4-[4-[[[amino(thiomorpholin-4-yl)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(C/N=C(\N)N3CCSCC3)cc2F)CC1.I |
| InChI | InChI=1S/C21H32FN5O2S.HI/c1-21(2,3)29-20(28)27-8-6-25(7-9-27)18-5-4-16(14-17(18)22)15-24-19(23)26-10-12-30-13-11-26;/h4-5,14H,6-13,15H2,1-3H3,(H2,23,24);1H |
| InChIKey | KEPLXQLWCPCWSK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 74.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|