C22H35FIN5O2 — CID 110988263
tert-butyl 4-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 110988263) has the molecular formula C22H35FIN5O2 and a molecular weight of 547.46 g/mol. Its IUPAC name is tert-butyl 4-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110988263 |
| Molecular Formula | C22H35FIN5O2 |
| Molecular Weight | 547.46 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | tert-butyl 4-[4-[[[(cyclopropylamino)-(ethylamino)methylidene]amino]methyl]-2-fluorophenyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1)NC1CC1.I |
| InChI | InChI=1S/C22H34FN5O2.HI/c1-5-24-20(26-17-7-8-17)25-15-16-6-9-19(18(23)14-16)27-10-12-28(13-11-27)21(29)30-22(2,3)4;/h6,9,14,17H,5,7-8,10-13,15H2,1-4H3,(H2,24,25,26);1H |
| InChIKey | GQWRVKCHJDLKOZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|