C19H29FN4O3 — CID 109467492
tert-butyl 3-[[N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109467492) has the molecular formula C19H29FN4O3 and a molecular weight of 380.46 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109467492 |
| Molecular Formula | C19H29FN4O3 |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[[4-fluoro-3-(hydroxymethyl)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(F)c(CO)c1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H29FN4O3/c1-5-21-17(22-9-13-6-7-16(20)14(8-13)12-25)23-15-10-24(11-15)18(26)27-19(2,3)4/h6-8,15,25H,5,9-12H2,1-4H3,(H2,21,22,23) |
| InChIKey | WRRVZIJFXHPMQV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|