C22H36N6O3 — CID 109466028
tert-butyl 3-[[N-ethyl-N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466028) has the molecular formula C22H36N6O3 and a molecular weight of 432.57 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466028 |
| Molecular Formula | C22H36N6O3 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[[4-(propan-2-ylcarbamoylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1ccc(NC(=O)NC(C)C)cc1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H36N6O3/c1-7-23-19(26-18-13-28(14-18)21(30)31-22(4,5)6)24-12-16-8-10-17(11-9-16)27-20(29)25-15(2)3/h8-11,15,18H,7,12-14H2,1-6H3,(H2,23,24,26)(H2,25,27,29) |
| InChIKey | KFBJISZMEIMOKS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|