C23H36N6O3 — CID 109466504
tert-butyl 3-[[N-ethyl-N'-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate (PubChem CID 109466504) has the molecular formula C23H36N6O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is tert-butyl 3-[[N-ethyl-N'-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[N-ethyl-N'-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 109466504 |
| Molecular Formula | C23H36N6O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | tert-butyl 3-[[N-ethyl-N'-[[3-(pyrrolidine-1-carbonylamino)phenyl]methyl]carbamimidoyl]amino]azetidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)N2CCCC2)c1)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H36N6O3/c1-5-24-20(26-19-15-29(16-19)22(31)32-23(2,3)4)25-14-17-9-8-10-18(13-17)27-21(30)28-11-6-7-12-28/h8-10,13,19H,5-7,11-12,14-16H2,1-4H3,(H,27,30)(H2,24,25,26) |
| InChIKey | FWQXYTOMYZYEJN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|