C21H33FN4OS — CID 111530727
1-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine (PubChem CID 111530727) has the molecular formula C21H33FN4OS and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine.
| Compound Name | 1-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine |
|---|---|
| PubChem CID | 111530727 |
| Molecular Formula | C21H33FN4OS |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 1-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(3-methylsulfanylcyclopentyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)NC1CCC(SC)C1 |
| InChI | InChI=1S/C21H33FN4OS/c1-3-23-21(25-16-5-6-18(13-16)28-2)24-14-15-4-7-20(19(22)12-15)26-10-8-17(27)9-11-26/h4,7,12,16-18,27H,3,5-6,8-11,13-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | PYLHEXADLKXPME-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|