C22H37FN6O — CID 111767703
N-tert-butyl-2-[[N-ethyl-N'-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]carbamimidoyl]amino]acetamide (PubChem CID 111767703) has the molecular formula C22H37FN6O and a molecular weight of 420.58 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-ethyl-N'-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-ethyl-N'-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111767703 |
| Molecular Formula | C22H37FN6O |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | N-tert-butyl-2-[[N-ethyl-N'-[[4-(4-ethylpiperazin-1-yl)-3-fluorophenyl]methyl]carbamimidoyl]amino]acetamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(CC)CC2)c(F)c1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H37FN6O/c1-6-24-21(26-16-20(30)27-22(3,4)5)25-15-17-8-9-19(18(23)14-17)29-12-10-28(7-2)11-13-29/h8-9,14H,6-7,10-13,15-16H2,1-5H3,(H,27,30)(H2,24,25,26) |
| InChIKey | SEBDJOKJOJXFJO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|