C21H35N5O2 — CID 111383602
4-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide (PubChem CID 111383602) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is 4-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 111383602 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 4-[[[[[2-(tert-butylamino)-2-oxoethyl]amino]-(ethylamino)methylidene]amino]methyl]-N,N-diethylbenzamide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)N(CC)CC)cc1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C21H35N5O2/c1-7-22-20(24-15-18(27)25-21(4,5)6)23-14-16-10-12-17(13-11-16)19(28)26(8-2)9-3/h10-13H,7-9,14-15H2,1-6H3,(H,25,27)(H2,22,23,24) |
| InChIKey | BYMVFOVYWORYKT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|