C20H33N5OS — CID 111383748
N-tert-butyl-2-[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111383748) has the molecular formula C20H33N5OS and a molecular weight of 391.59 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383748 |
| Molecular Formula | C20H33N5OS |
| Molecular Weight | 391.59 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | N-tert-butyl-2-[[N-ethyl-N'-[(4-thiomorpholin-4-ylphenyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C20H33N5OS/c1-5-21-19(23-15-18(26)24-20(2,3)4)22-14-16-6-8-17(9-7-16)25-10-12-27-13-11-25/h6-9H,5,10-15H2,1-4H3,(H,24,26)(H2,21,22,23) |
| InChIKey | WULXMFBGFNKBTK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|