C17H26F3IN4S — CID 109471904
1-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471904) has the molecular formula C17H26F3IN4S and a molecular weight of 502.39 g/mol. Its IUPAC name is 1-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471904 |
| Molecular Formula | C17H26F3IN4S |
| Molecular Weight | 502.39 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 1-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C17H25F3N4S.HI/c1-2-21-16(22-8-7-17(18,19)20)23-13-14-3-5-15(6-4-14)24-9-11-25-12-10-24;/h3-6H,2,7-13H2,1H3,(H2,21,22,23);1H |
| InChIKey | XAEDTJIIMMVSCZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|