C21H27F2IN4S — CID 111902232
1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111902232) has the molecular formula C21H27F2IN4S and a molecular weight of 532.44 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111902232 |
| Molecular Formula | C21H27F2IN4S |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-ethyl-2-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCSCC2)cc1)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C21H26F2N4S.HI/c1-2-24-21(26-15-17-13-18(22)5-8-20(17)23)25-14-16-3-6-19(7-4-16)27-9-11-28-12-10-27;/h3-8,13H,2,9-12,14-15H2,1H3,(H2,24,25,26);1H |
| InChIKey | OEUHKYYBIJCIIZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|