C20H24F2N4S — CID 111902075
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine (PubChem CID 111902075) has the molecular formula C20H24F2N4S and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111902075 |
| Molecular Formula | C20H24F2N4S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCSCC2)cc1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C20H24F2N4S/c1-23-20(25-14-16-12-17(21)4-7-19(16)22)24-13-15-2-5-18(6-3-15)26-8-10-27-11-9-26/h2-7,12H,8-11,13-14H2,1H3,(H2,23,24,25) |
| InChIKey | FYHBTMRGRFOHJW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|