C23H30FIN4S — CID 111639195
1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111639195) has the molecular formula C23H30FIN4S and a molecular weight of 540.49 g/mol. Its IUPAC name is 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111639195 |
| Molecular Formula | C23H30FIN4S |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 1-[[1-(3-fluorophenyl)cyclopropyl]methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(N2CCSCC2)cc1)NCC1(c2cccc(F)c2)CC1.I |
| InChI | InChI=1S/C23H29FN4S.HI/c1-25-22(27-17-23(9-10-23)19-3-2-4-20(24)15-19)26-16-18-5-7-21(8-6-18)28-11-13-29-14-12-28;/h2-8,15H,9-14,16-17H2,1H3,(H2,25,26,27);1H |
| InChIKey | CHCCGVVABHJEDN-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|