C20H26ClIN4S — CID 111174015
1-[(2-chlorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111174015) has the molecular formula C20H26ClIN4S and a molecular weight of 516.88 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111174015 |
| Molecular Formula | C20H26ClIN4S |
| Molecular Weight | 516.88 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(N2CCSCC2)cc1)NCc1ccccc1Cl.I |
| InChI | InChI=1S/C20H25ClN4S.HI/c1-22-20(24-15-17-4-2-3-5-19(17)21)23-14-16-6-8-18(9-7-16)25-10-12-26-13-11-25;/h2-9H,10-15H2,1H3,(H2,22,23,24);1H |
| InChIKey | RVIYFFIXNKUQCE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|