C15H24ClIN4O2S2 — CID 111833186
1-[(2-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111833186) has the molecular formula C15H24ClIN4O2S2 and a molecular weight of 518.87 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111833186 |
| Molecular Formula | C15H24ClIN4O2S2 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCSCC1)NCc1ccccc1Cl.I |
| InChI | InChI=1S/C15H23ClN4O2S2.HI/c1-17-15(19-12-13-4-2-3-5-14(13)16)18-6-11-24(21,22)20-7-9-23-10-8-20;/h2-5H,6-12H2,1H3,(H2,17,18,19);1H |
| InChIKey | GDRATADKCYWSQV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|