C14H24N4O3S2 — CID 111833501
1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111833501) has the molecular formula C14H24N4O3S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111833501 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccco1)NCCS(=O)(=O)N1CCSCC1 |
| InChI | InChI=1S/C14H24N4O3S2/c1-15-14(16-5-4-13-3-2-9-21-13)17-6-12-23(19,20)18-7-10-22-11-8-18/h2-3,9H,4-8,10-12H2,1H3,(H2,15,16,17) |
| InChIKey | DCMVTWZZCXOISP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|