C19H34IN5O3S2 — CID 111833408
1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111833408) has the molecular formula C19H34IN5O3S2 and a molecular weight of 571.55 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111833408 |
| Molecular Formula | C19H34IN5O3S2 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.11 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methyl-3-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCSCC1)NCC(c1ccco1)N1CCCCC1.I |
| InChI | InChI=1S/C19H33N5O3S2.HI/c1-20-19(21-7-15-29(25,26)24-10-13-28-14-11-24)22-16-17(18-6-5-12-27-18)23-8-3-2-4-9-23;/h5-6,12,17H,2-4,7-11,13-16H2,1H3,(H2,20,21,22);1H |
| InChIKey | VPDPFWFSGRNLNR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|