C17H30N4O3S — CID 111303767
1-(2-ethylsulfonylethyl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine (PubChem CID 111303767) has the molecular formula C17H30N4O3S and a molecular weight of 370.52 g/mol. Its IUPAC name is 1-(2-ethylsulfonylethyl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-(2-ethylsulfonylethyl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111303767 |
| Molecular Formula | C17H30N4O3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-(2-ethylsulfonylethyl)-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C17H30N4O3S/c1-3-25(22,23)13-9-19-17(18-2)20-14-15(16-8-7-12-24-16)21-10-5-4-6-11-21/h7-8,12,15H,3-6,9-11,13-14H2,1-2H3,(H2,18,19,20) |
| InChIKey | AKRGDTWGGQSYLM-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 86.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|