C20H35N5O3S — CID 111783999
1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine (PubChem CID 111783999) has the molecular formula C20H35N5O3S and a molecular weight of 425.60 g/mol. Its IUPAC name is 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine.
| Compound Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111783999 |
| Molecular Formula | C20H35N5O3S |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 1-[2-(cyclobutylmethylsulfamoyl)ethyl]-3-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)NCC1CCC1)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C20H35N5O3S/c1-21-20(22-10-14-29(26,27)24-15-17-7-5-8-17)23-16-18(19-9-6-13-28-19)25-11-3-2-4-12-25/h6,9,13,17-18,24H,2-5,7-8,10-12,14-16H2,1H3,(H2,21,22,23) |
| InChIKey | MKEYOEILSXDABE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|