C13H22N4O2S3 — CID 111833359
2-methyl-1-(2-thiomorpholin-4-ylsulfonylethyl)-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111833359) has the molecular formula C13H22N4O2S3 and a molecular weight of 362.55 g/mol. Its IUPAC name is 2-methyl-1-(2-thiomorpholin-4-ylsulfonylethyl)-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-(2-thiomorpholin-4-ylsulfonylethyl)-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111833359 |
| Molecular Formula | C13H22N4O2S3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-methyl-1-(2-thiomorpholin-4-ylsulfonylethyl)-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | C/N=C(/NCCS(=O)(=O)N1CCSCC1)NCc1cccs1 |
| InChI | InChI=1S/C13H22N4O2S3/c1-14-13(16-11-12-3-2-7-21-12)15-4-10-22(18,19)17-5-8-20-9-6-17/h2-3,7H,4-6,8-11H2,1H3,(H2,14,15,16) |
| InChIKey | WQZPLXAWBYZCNY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|